EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15FN4O4 |
| Net Charge | 0 |
| Average Mass | 370.340 |
| Monoisotopic Mass | 370.10773 |
| SMILES | O=[N+]([O-])c1cn2c(n1)O[C@@H](COc1ccc(-c3ccc(F)cc3)nc1)CC2 |
| InChI | InChI=1S/C18H15FN4O4/c19-13-3-1-12(2-4-13)16-6-5-14(9-20-16)26-11-15-7-8-22-10-17(23(24)25)21-18(22)27-15/h1-6,9-10,15H,7-8,11H2/t15-/m1/s1 |
| InChIKey | USIKCXQLXHGVDD-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Role: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dndi-0690 (CHEBI:756569) has role antileishmanial agent (CHEBI:70868) |
| dndi-0690 (CHEBI:756569) is a C-nitro compound (CHEBI:35716) |
| dndi-0690 (CHEBI:756569) is a imidazoles (CHEBI:24780) |
| Synonym | Source |
|---|---|
| Dndi-0690 | ChEMBL |
| Citations |
|---|