EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22F4N6O3S |
| Net Charge | 0 |
| Average Mass | 586.571 |
| Monoisotopic Mass | 586.14102 |
| SMILES | Cn1cc(S(=O)(=O)N2CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@]3(C(=O)c3cc(C(F)(F)F)ccn3)C2)cn1 |
| InChI | InChI=1S/C27H22F4N6O3S/c1-35-15-22(14-33-35)41(39,40)36-9-7-18-11-24-17(13-34-37(24)21-4-2-20(28)3-5-21)12-26(18,16-36)25(38)23-10-19(6-8-32-23)27(29,30)31/h2-6,8,10-11,13-15H,7,9,12,16H2,1H3/t26-/m0/s1 |
| InChIKey | WANIDIGFXJFFEL-SANMLTNESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| relacorilant (CHEBI:756567) has role antineoplastic agent (CHEBI:35610) |
| relacorilant (CHEBI:756567) is a pyrazoles (CHEBI:26410) |
| relacorilant (CHEBI:756567) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| relacorilant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cort 125134 | ChEMBL |
| Cort-125134 | ChEMBL |
| CORT125134 | ChEMBL |
| Citations |
|---|