EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30Cl2N6O4 |
| Net Charge | 0 |
| Average Mass | 561.470 |
| Monoisotopic Mass | 560.17056 |
| SMILES | C=CC(=O)N1CCN(CCCn2c(=O)c(-c3c(Cl)c(OC)cc(OC)c3Cl)cc3cnc(NC)nc32)CC1 |
| InChI | InChI=1S/C26H30Cl2N6O4/c1-5-20(35)33-11-9-32(10-12-33)7-6-8-34-24-16(15-30-26(29-2)31-24)13-17(25(34)36)21-22(27)18(37-3)14-19(38-4)23(21)28/h5,13-15H,1,6-12H2,2-4H3,(H,29,30,31) |
| InChIKey | PUIXMSRTTHLNKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prn-1371 (CHEBI:756566) has role antineoplastic agent (CHEBI:35610) |
| prn-1371 (CHEBI:756566) is a pyridopyrimidine (CHEBI:38932) |
| Synonyms | Source |
|---|---|
| Prn 1371 | ChEMBL |
| Prn-1371 | ChEMBL |
| PRN1371 | ChEMBL |
| Citations |
|---|