EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H19FO5S |
| Net Charge | 0 |
| Average Mass | 462.498 |
| Monoisotopic Mass | 462.09372 |
| SMILES | Cc1cc(F)cc(C)c1C(=O)c1sc2cc(O)ccc2c1Oc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C26H19FO5S/c1-14-11-17(27)12-15(2)23(14)24(31)26-25(20-9-6-18(28)13-21(20)33-26)32-19-7-3-16(4-8-19)5-10-22(29)30/h3-13,28H,1-2H3,(H,29,30)/b10-5+ |
| InChIKey | KOAITBOFZOEDOC-BJMVGYQFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rintodestrant (CHEBI:756559) has role antineoplastic agent (CHEBI:35610) |
| rintodestrant (CHEBI:756559) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| rintodestrant | WHO MedNet |
| Synonyms | Source |
|---|---|
| G1T-48 | ChEMBL |
| G1T48 | ChEMBL |
| GIT-48 | ChEMBL |
| GIT48 | ChEMBL |
| XR5-28 | ChEMBL |
| Citations |
|---|