EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756531 - stercuronium
| Formula | C26H43N2 |
| Net Charge | +1 |
| Average Mass | 383.644 |
| Monoisotopic Mass | 383.34208 |
| SMILES | [H][C@@]12C=CC3=C[C@@H]([N+](C)(C)CC)CC[C@]3(C)[C@@]1([H])CC[C@]13CN(C)[C@@H](C)[C@@]1([H])CC[C@@]23[H] |
| InChI | InChI=1S/C26H43N2/c1-7-28(5,6)20-12-14-25(3)19(16-20)8-9-21-23(25)13-15-26-17-27(4)18(2)22(26)10-11-24(21)26/h8-9,16,18,20-24H,7,10-15,17H2,1-6H3/q+1/t18-,20-,21+,22+,23-,24-,25-,26-/m0/s1 |
| InChIKey | GGXDVUAOXCBCBN-HJZGYWQISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stercuronium (CHEBI:756531) is a steroid alkaloid (CHEBI:26767) |
| Synonyms | Source |
|---|---|
| Stercuronium cation | ChEMBL |
| Stercuronium ion | ChEMBL |