EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75648 - 4-(4-nitrophenylazo)aniline
| Formula | C12H10N4O2 |
| Net Charge | 0 |
| Average Mass | 242.238 |
| Monoisotopic Mass | 242.08038 |
| SMILES | Nc1ccc(N=Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C12H10N4O2/c13-9-1-3-10(4-2-9)14-15-11-5-7-12(8-6-11)16(17)18/h1-8H,13H2 |
| InChIKey | UNBOSJFEZZJZLR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(4-nitrophenylazo)aniline (CHEBI:75648) has functional parent azobenzene (CHEBI:190358) |
| 4-(4-nitrophenylazo)aniline (CHEBI:75648) has role allergen (CHEBI:50904) |
| 4-(4-nitrophenylazo)aniline (CHEBI:75648) has role dye (CHEBI:37958) |
| 4-(4-nitrophenylazo)aniline (CHEBI:75648) is a azobenzenes (CHEBI:22682) |
| 4-(4-nitrophenylazo)aniline (CHEBI:75648) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 4-[(4-nitrophenyl)diazenyl]aniline |
| Synonyms | Source |
|---|---|
| Disperse orange 3 | ChemIDplus |
| 4-[(4-Nitrophenyl)azo]benzenamin | ChemIDplus |
| 4-(2-(4-nitrophenyl)diazenyl)benzenamine | ChemIDplus |
| 4-((nitrophenyl)azo)benzeneamine | ChemIDplus |
| 4-[(4-nitrophenyl)azo]benzenamine | ChemIDplus |
| 4-((4-nitrophenyl)diazenyl)aniline | ChEBI |
| Citations |
|---|