EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22FN9O2 |
| Net Charge | 0 |
| Average Mass | 415.433 |
| Monoisotopic Mass | 415.18805 |
| SMILES | C=CC(=O)N[C@@H]1CN(c2nc(Nc3cn(C)nc3OC)c3ncn(C)c3n2)C[C@H]1F |
| InChI | InChI=1S/C18H22FN9O2/c1-5-13(29)21-11-8-28(6-10(11)19)18-23-15(14-16(24-18)26(2)9-20-14)22-12-7-27(3)25-17(12)30-4/h5,7,9-11H,1,6,8H2,2-4H3,(H,21,29)(H,22,23,24)/t10-,11-/m1/s1 |
| InChIKey | JYIUNVOCEFIUIU-GHMZBOCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mavelertinib (CHEBI:756454) has role antineoplastic agent (CHEBI:35610) |
| mavelertinib (CHEBI:756454) is a purines (CHEBI:26401) |
| INN | Source |
|---|---|
| mavelertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Egfr t790m inhibitor pf-06747775 | ChEMBL |
| PF-06747775 | ChEMBL |
| Citations |
|---|