EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24F2N2O5 |
| Net Charge | 0 |
| Average Mass | 446.450 |
| Monoisotopic Mass | 446.16533 |
| SMILES | CCOc1ccccc1C(=O)NCc1coc(-c2ccc(OC(F)F)c(OC(C)C)c2)n1 |
| InChI | InChI=1S/C23H24F2N2O5/c1-4-29-18-8-6-5-7-17(18)21(28)26-12-16-13-30-22(27-16)15-9-10-19(32-23(24)25)20(11-15)31-14(2)3/h5-11,13-14,23H,4,12H2,1-3H3,(H,26,28) |
| InChIKey | VFBILHPIHUPBPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difamilast (CHEBI:756452) has role dermatologic drug (CHEBI:50177) |
| difamilast (CHEBI:756452) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| difamilast | WHO MedNet |
| Synonym | Source |
|---|---|
| OPA-15406 | ChEMBL |