EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24N4O5 |
| Net Charge | 0 |
| Average Mass | 472.501 |
| Monoisotopic Mass | 472.17467 |
| SMILES | CNc1nc(-c2cccc(NC(=O)c3ccc(C(=O)OC)cc3)c2)c2cc(OC)c(OC)cc2n1 |
| InChI | InChI=1S/C26H24N4O5/c1-27-26-29-20-14-22(34-3)21(33-2)13-19(20)23(30-26)17-6-5-7-18(12-17)28-24(31)15-8-10-16(11-9-15)25(32)35-4/h5-14H,1-4H3,(H,28,31)(H,27,29,30) |
| InChIKey | BBTFKAOFCSOZMB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lotamilast (CHEBI:756451) has role dermatologic drug (CHEBI:50177) |
| lotamilast (CHEBI:756451) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| lotamilast | WHO MedNet |
| Synonyms | Source |
|---|---|
| E-6005 | ChEMBL |
| E6005 | ChEMBL |
| RVT-501 | ChEMBL |
| Citations |
|---|