EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756449 - talirine
| Formula | C60H64N8O12 |
| Net Charge | 0 |
| Average Mass | 1089.216 |
| Monoisotopic Mass | 1088.46437 |
| SMILES | [H][C@@](C)(NC(=O)[C@@]([H])(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C)C(=O)Nc1ccc(C2=CN3C(=O)c4cc(OC)c(OCCCOc5cc6c(cc5OC)C(=O)N5C=C(c7ccc(OC)cc7)C[C@@]5([H])C=N6)cc4N=C[C@]3([H])C2)cc1 |
| InChI | InChI=1S/C60H64N8O12/c1-35(2)56(65-53(69)11-8-7-9-22-66-54(70)20-21-55(66)71)58(73)63-36(3)57(72)64-41-16-12-37(13-17-41)39-25-42-31-61-47-29-51(49(77-5)27-45(47)59(74)67(42)33-39)79-23-10-24-80-52-30-48-46(28-50(52)78-6)60(75)68-34-40(26-43(68)32-62-48)38-14-18-44(76-4)19-15-38/h12-21,27-36,42-43,56H,7-11,22-26H2,1-6H3,(H,63,73)(H,64,72)(H,65,69)/t36-,42-,43-,56-/m0/s1 |
| InChIKey | TWQIMWSQDICMSE-DGCIIGOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talirine (CHEBI:756449) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| Mc-val-ala-pbd | ChEMBL |
| SGD-1910 | ChEMBL |
| Talirine | ChEMBL |
| Talirine maleimide | ChEMBL |
| Talirine, maleimide- | ChEMBL |
| Talirine pyrrole-2,5-dione | ChEMBL |