EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N4O7S |
| Net Charge | 0 |
| Average Mass | 324.315 |
| Monoisotopic Mass | 324.07397 |
| SMILES | [H][C@@]12CC[C@@H](C(=O)NOCCN)N(C1)C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C9H16N4O7S/c10-3-4-19-11-8(14)7-2-1-6-5-12(7)9(15)13(6)20-21(16,17)18/h6-7H,1-5,10H2,(H,11,14)(H,16,17,18)/t6-,7+/m1/s1 |
| InChIKey | RSBPYSTVZQAADE-RQJHMYQMSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nacubactam (CHEBI:756443) has role antibacterial agent (CHEBI:33282) |
| nacubactam (CHEBI:756443) has role antiinfective agent (CHEBI:35441) |
| nacubactam (CHEBI:756443) has role renoprotective agent (CHEBI:231911) |
| nacubactam (CHEBI:756443) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| nacubactam | WHO MedNet |
| Synonyms | Source |
|---|---|
| FPI-1459 | ChEMBL |
| RG-6080 | ChEMBL |
| RG6080 | ChEMBL |
| RO-7079901 | ChEMBL |
| RO7079901 | ChEMBL |
| Citations |
|---|