EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35NO2 |
| Net Charge | 0 |
| Average Mass | 321.505 |
| Monoisotopic Mass | 321.26678 |
| SMILES | [H][C@@]1(CN)[C@@]([H])([C@@]2(C)CC[C@H](O)C[C@@H]2CO)CC[C@]2(C)C(=C)CC[C@@]12[H] |
| InChI | InChI=1S/C20H35NO2/c1-13-4-5-17-16(11-21)18(7-9-19(13,17)2)20(3)8-6-15(23)10-14(20)12-22/h14-18,22-23H,1,4-12,21H2,2-3H3/t14-,15+,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | MDEJTPWQNNMAQF-BVMLLJBZSA-N |
| Roles Classification |
|---|
| Application: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosiptor (CHEBI:756440) has role dermatologic drug (CHEBI:50177) |
| rosiptor (CHEBI:756440) is a cyclohexanols (CHEBI:23480) |
| INN | Source |
|---|---|
| rosiptor | WHO MedNet |
| Synonyms | Source |
|---|---|
| AQX-1125 | ChEMBL |
| AQX-1125 free base | ChEMBL |