EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H38O18 |
| Net Charge | 0 |
| Average Mass | 866.781 |
| Monoisotopic Mass | 866.20581 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| InChI | InChI=1S/C45H38O18/c46-18-10-27(54)33-32(11-18)61-42(16-2-5-21(48)25(52)8-16)39(59)37(33)35-29(56)14-30(57)36-38(40(60)43(63-45(35)36)17-3-6-22(49)26(53)9-17)34-28(55)13-23(50)19-12-31(58)41(62-44(19)34)15-1-4-20(47)24(51)7-15/h1-11,13-14,31,37-43,46-60H,12H2/t31-,37-,38+,39-,40-,41+,42+,43+/m0/s1 |
| InChIKey | MOJZMWJRUKIQGL-WNCKYJNFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin C2 (CHEBI:75644) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin C2 (CHEBI:75644) has role antioxidant (CHEBI:22586) |
| procyanidin C2 (CHEBI:75644) has role metabolite (CHEBI:25212) |
| procyanidin C2 (CHEBI:75644) is a hydroxyflavan (CHEBI:72010) |
| procyanidin C2 (CHEBI:75644) is a polyphenol (CHEBI:26195) |
| procyanidin C2 (CHEBI:75644) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,2''R,3S,3'S,3''S,4S,4'R)-2,2',2''-tris(3,4-dihydroxyphenyl)-3,3',3'',4,4',4''-hexahydro-2H,2'H,2''H-4,8':4',8''-terchromene-3,3',3'',5,5',5'',7,7',7''-nonol |
| Synonyms | Source |
|---|---|
| C-(4,8)-C-(4,8)-C | ChEBI |
| catechin-(4α→8)-catechin-(4α→8)-catechin | ChEBI |
| Procyanidin trimer C2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Procyanidin_C2 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3587024 | Reaxys |
| Citations |
|---|