EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28Cl2N4O2 |
| Net Charge | 0 |
| Average Mass | 415.365 |
| Monoisotopic Mass | 414.15893 |
| SMILES | Cn1c(CCCCCCC(=O)NO)nc2cc(N(CCCl)CCCl)ccc21 |
| InChI | InChI=1S/C19H28Cl2N4O2/c1-24-17-9-8-15(25(12-10-20)13-11-21)14-16(17)22-18(24)6-4-2-3-5-7-19(26)23-27/h8-9,14,27H,2-7,10-13H2,1H3,(H,23,26) |
| InChIKey | GISXTRIGVCKQBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinostamustine (CHEBI:756429) has role antineoplastic agent (CHEBI:35610) |
| tinostamustine (CHEBI:756429) is a benzimidazoles (CHEBI:22715) |
| INNs | Source |
|---|---|
| tinostamustina | WHO MedNet |
| tinostamustine | WHO MedNet |
| Synonyms | Source |
|---|---|
| EDO-S 101 | ChEMBL |
| EDO-S-101 | ChEMBL |
| EDO-S101 | ChEMBL |
| Citations |
|---|