EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29F5O4S |
| Net Charge | 0 |
| Average Mass | 544.582 |
| Monoisotopic Mass | 544.17067 |
| SMILES | [H][C@@]12CC[C@@](O)(C(F)(F)C(F)(F)F)[C@@]1(C)C[C@H](c1ccc(S(C)(=O)=O)cc1)C1=C3CCC(=O)C=C3CC[C@]12[H] |
| InChI | InChI=1S/C27H29F5O4S/c1-24-14-21(15-3-7-18(8-4-15)37(2,35)36)23-19-10-6-17(33)13-16(19)5-9-20(23)22(24)11-12-25(24,34)26(28,29)27(30,31)32/h3-4,7-8,13,20-22,34H,5-6,9-12,14H2,1-2H3/t20-,21+,22-,24-,25-/m0/s1 |
| InChIKey | JUFWQQVHQFDUOD-ANRPBIDPSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilaprisan (CHEBI:756425) has role antineoplastic agent (CHEBI:35610) |
| vilaprisan (CHEBI:756425) is a 3-oxo steroid (CHEBI:47788) |
| INN | Source |
|---|---|
| vilaprisan | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY-1002670 | ChEMBL |
| BAY1002670 | ChEMBL |