EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C19H17F6N7O |
| Net Charge | 0 |
| Average Mass | 569.488 |
| Monoisotopic Mass | 569.12799 |
| SMILES | CC(C)(O)CNc1nc(Nc2ccnc(C(F)(F)F)c2)nc(-c2cccc(C(F)(F)F)n2)n1.CS(=O)(=O)O |
| InChI | InChI=1S/C19H17F6N7O.CH4O3S/c1-17(2,33)9-27-15-30-14(11-4-3-5-12(29-11)18(20,21)22)31-16(32-15)28-10-6-7-26-13(8-10)19(23,24)25;1-5(2,3)4/h3-8,33H,9H2,1-2H3,(H2,26,27,28,30,31,32);1H3,(H,2,3,4) |
| InChIKey | ORZHZQZYWXEDDL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enasidenib mesylate (CHEBI:756421) has role antineoplastic agent (CHEBI:35610) |
| enasidenib mesylate (CHEBI:756421) is a chloropyridine (CHEBI:39173) |
| Synonyms | Source |
|---|---|
| AG-221 mesylate | ChEMBL |
| Enasidenib mesilate | ChEMBL |
| Enasidenib mesylate | ChEMBL |
| Enasidenib methanesulfonate | ChEMBL |
| Citations |
|---|