EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756419 - azeliragon
| Formula | C32H38ClN3O2 |
| Net Charge | 0 |
| Average Mass | 532.128 |
| Monoisotopic Mass | 531.26526 |
| SMILES | CCCCc1nc(-c2ccc(OCCCN(CC)CC)cc2)cn1-c1ccc(Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C32H38ClN3O2/c1-4-7-9-32-34-31(25-10-16-28(17-11-25)37-23-8-22-35(5-2)6-3)24-36(32)27-14-20-30(21-15-27)38-29-18-12-26(33)13-19-29/h10-21,24H,4-9,22-23H2,1-3H3 |
| InChIKey | KJNNWYBAOPXVJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azeliragon (CHEBI:756419) has role antineoplastic agent (CHEBI:35610) |
| azeliragon (CHEBI:756419) has role antiviral agent (CHEBI:22587) |
| azeliragon (CHEBI:756419) has role hypoglycemic agent (CHEBI:35526) |
| azeliragon (CHEBI:756419) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| azeliragon | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-04494700 | ChEMBL |
| TTP448 | ChEMBL |
| TTP-488 | ChEMBL |
| TTP488 | ChEMBL |
| Citations |
|---|