EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27N3O5 |
| Net Charge | 0 |
| Average Mass | 449.507 |
| Monoisotopic Mass | 449.19507 |
| SMILES | O=C1CC[C@H](N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N3O5/c29-23-9-8-21(24(30)26-23)28-15-20-19(25(28)31)2-1-3-22(20)33-16-18-6-4-17(5-7-18)14-27-10-12-32-13-11-27/h1-7,21H,8-16H2,(H,26,29,30)/t21-/m0/s1 |
| InChIKey | IXZOHGPZAQLIBH-NRFANRHFSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iberdomide (CHEBI:756418) has role antineoplastic agent (CHEBI:35610) |
| iberdomide (CHEBI:756418) is a isoindoles (CHEBI:24897) |
| INNs | Source |
|---|---|
| iberdomida | WHO MedNet |
| iberdomide | WHO MedNet |
| Citations |
|---|