EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H29F2N5O4S |
| Net Charge | 0 |
| Average Mass | 629.689 |
| Monoisotopic Mass | 629.19083 |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C(=O)Nc6ccc(F)cc6)CC5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C33H29F2N5O4S/c1-43-15-14-36-18-20-2-8-25(38-19-20)29-17-26-30(45-29)28(10-13-37-26)44-27-9-7-23(16-24(27)35)40-32(42)33(11-12-33)31(41)39-22-5-3-21(34)4-6-22/h2-10,13,16-17,19,36H,11-12,14-15,18H2,1H3,(H,39,41)(H,40,42) |
| InChIKey | WLAVZAAODLTUSW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sitravatinib (CHEBI:756417) has role antineoplastic agent (CHEBI:35610) |
| sitravatinib (CHEBI:756417) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| MG-516 | ChEMBL |
| MG-91516 | ChEMBL |
| MGCD-516 | ChEMBL |
| MGCD516 | ChEMBL |
| Sitravatinib | ChEMBL |
| Citations |
|---|