EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C31H36F6N4O5P.Cl |
| Net Charge | 0 |
| Average Mass | 761.528 |
| Monoisotopic Mass | 760.17828 |
| SMILES | Cc1ccccc1-c1cc(N2CC[N+](C)(COP(=O)(O)O)CC2)ncc1N(C)C(=O)C(C)(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cl.[Cl-] |
| InChI | InChI=1S/C31H35F6N4O5P.2ClH/c1-20-8-6-7-9-24(20)25-17-27(40-10-12-41(5,13-11-40)19-46-47(43,44)45)38-18-26(25)39(4)28(42)29(2,3)21-14-22(30(32,33)34)16-23(15-21)31(35,36)37;;/h6-9,14-18H,10-13,19H2,1-5H3,(H-,43,44,45);2*1H |
| InChIKey | LBTQUZNIWCWBNN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fosnetupitant chloride hydrochloride (CHEBI:756412) has role antiemetic (CHEBI:50919) |
| fosnetupitant chloride hydrochloride (CHEBI:756412) is a piperazines (CHEBI:26144) |
| fosnetupitant chloride hydrochloride (CHEBI:756412) is a pyridines (CHEBI:26421) |
| Synonyms | Source |
|---|---|
| 08-PNET | ChEMBL |
| Fosnetupitant chloride | ChEMBL |
| Fosnetupitant chloride hydrochloride | ChEMBL |
| Fosnetupitant dihydrochloride | ChEMBL |
| Brand Names | Source |
|---|---|
| Fosnetupitant chloride hydrochloride component of akynzeo | ChEMBL |
| Fosnetupitant chloride hydrochloride component of akynzeo for injection | ChEMBL |