EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H27F2N5O3S2 |
| Net Charge | 0 |
| Average Mass | 619.719 |
| Monoisotopic Mass | 619.15234 |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=S)NC(=O)Cc5ccc(F)cc5)cc4F)c3s2)nc1 |
| InChI | InChI=1S/C31H27F2N5O3S2/c1-40-13-12-34-17-20-4-8-24(36-18-20)28-16-25-30(43-28)27(10-11-35-25)41-26-9-7-22(15-23(26)33)37-31(42)38-29(39)14-19-2-5-21(32)6-3-19/h2-11,15-16,18,34H,12-14,17H2,1H3,(H2,37,38,39,42) |
| InChIKey | YRCHYHRCBXNYNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glesatinib (CHEBI:756408) has role antineoplastic agent (CHEBI:35610) |
| glesatinib (CHEBI:756408) is a thioureas (CHEBI:51276) |
| INN | Source |
|---|---|
| glesatinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| MG-90265 | ChEMBL |
| MG90265 | ChEMBL |
| MG90265gly | ChEMBL |
| MG90265H9 | ChEMBL |
| MG-90265X | ChEMBL |
| MG90265X | ChEMBL |
| Citations |
|---|