EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H27N3O5 |
| Net Charge | 0 |
| Average Mass | 485.968 |
| Monoisotopic Mass | 485.17175 |
| SMILES | Cl.O=C1CC[C@H](N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N3O5.ClH/c29-23-9-8-21(24(30)26-23)28-15-20-19(25(28)31)2-1-3-22(20)33-16-18-6-4-17(5-7-18)14-27-10-12-32-13-11-27;/h1-7,21H,8-16H2,(H,26,29,30);1H/t21-;/m0./s1 |
| InChIKey | VVHQVXXPZDALDV-BOXHHOBZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iberdomide hydrochloride (CHEBI:756406) has role antineoplastic agent (CHEBI:35610) |
| iberdomide hydrochloride (CHEBI:756406) is a isoindoles (CHEBI:24897) |
| Synonyms | Source |
|---|---|
| CC-220 | ChEMBL |
| Cc-220 hydrochloride | ChEMBL |
| Iberdomide hydrochloride | ChEMBL |