EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756376 - apimostinel
| Formula | C25H37N5O6 |
| Net Charge | 0 |
| Average Mass | 503.600 |
| Monoisotopic Mass | 503.27438 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@@]1(Cc1ccccc1)C(=O)N[C@H](C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C25H37N5O6/c1-15(31)19(26)23(35)29-12-6-10-18(29)22(34)30-13-7-11-25(30,14-17-8-4-3-5-9-17)24(36)28-20(16(2)32)21(27)33/h3-5,8-9,15-16,18-20,31-32H,6-7,10-14,26H2,1-2H3,(H2,27,33)(H,28,36)/t15-,16-,18+,19+,20+,25-/m1/s1 |
| InChIKey | DVBUEXCIEIAXPM-PJUQSVSOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apimostinel (CHEBI:756376) has role antidepressant (CHEBI:35469) |
| apimostinel (CHEBI:756376) has role antipsychotic agent (CHEBI:35476) |
| apimostinel (CHEBI:756376) is a oligopeptide (CHEBI:25676) |
| INN | Source |
|---|---|
| apimostinel | WHO MedNet |
| Synonyms | Source |
|---|---|
| NRX-1074 | ChEMBL |
| NRX1074 | ChEMBL |