EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O3S.C31H24F3N5O3 |
| Net Charge | 0 |
| Average Mass | 743.764 |
| Monoisotopic Mass | 743.20254 |
| SMILES | CC(C)Oc1ccc(-c2nn([C@@H](C)c3oc4ccc(F)cc4c(=O)c3-c3cccc(F)c3)c3ncnc(N)c23)cc1F.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C31H24F3N5O3.C7H8O3S/c1-15(2)41-24-9-7-18(12-22(24)34)27-26-30(35)36-14-37-31(26)39(38-27)16(3)29-25(17-5-4-6-19(32)11-17)28(40)21-13-20(33)8-10-23(21)42-29;1-6-2-4-7(5-3-6)11(8,9)10/h4-16H,1-3H3,(H2,35,36,37);2-5H,1H3,(H,8,9,10)/t16-;/m0./s1 |
| InChIKey | KYJWUPZPSXZEPG-NTISSMGPSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antifibrotic agent Any agent which acts to reduce fibrosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| umbralisib tosylate (CHEBI:756374) has role antifibrotic agent (CHEBI:233423) |
| umbralisib tosylate (CHEBI:756374) has role antineoplastic agent (CHEBI:35610) |
| umbralisib tosylate (CHEBI:756374) is a isoflavones (CHEBI:38757) |
| Synonyms | Source |
|---|---|
| RP-5307 | ChEMBL |
| TGR-1202 | ChEMBL |
| TGR-1202 (4-METHYLBENZENESULFONATE) | ChEMBL |
| Umbralisib tosylate | ChEMBL |
| Brand Name | Source |
|---|---|
| Ukoniq | ChEMBL |