EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756369 - pefcalcitol
| Formula | C26H34F5NO4 |
| Net Charge | 0 |
| Average Mass | 519.551 |
| Monoisotopic Mass | 519.24080 |
| SMILES | [H][C@@]12CC=C([C@H](C)OCC(=O)NCC(F)(F)C(F)(F)F)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C26H34F5NO4/c1-15-18(11-19(33)12-22(15)34)7-6-17-5-4-10-24(3)20(8-9-21(17)24)16(2)36-13-23(35)32-14-25(27,28)26(29,30)31/h6-8,16,19,21-22,33-34H,1,4-5,9-14H2,2-3H3,(H,32,35)/b17-6+,18-7-/t16-,19+,21-,22-,24+/m0/s1 |
| InChIKey | SVCSMAZYWOQCBW-NVJMFHFGSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| Application: | antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pefcalcitol (CHEBI:756369) has role antipsoriatic (CHEBI:50748) |
| pefcalcitol (CHEBI:756369) is a vitamin D (CHEBI:27300) |
| INN | Source |
|---|---|
| pefcalcitol | WHO MedNet |
| Synonyms | Source |
|---|---|
| M-5181 | ChEMBL |
| M5181 | ChEMBL |
| M-518101 | ChEMBL |
| M518101 | ChEMBL |