EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO.H2O4S.C10H15NO |
| Net Charge | 0 |
| Average Mass | 428.551 |
| Monoisotopic Mass | 428.19811 |
| SMILES | CN[C@@H](C)[C@@H](O)c1ccccc1.CN[C@@H](C)[C@@H](O)c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C10H15NO.H2O4S/c2*1-8(11-2)10(12)9-6-4-3-5-7-9;1-5(2,3)4/h2*3-8,10-12H,1-2H3;(H2,1,2,3,4)/t2*8-,10+;/m00./s1 |
| InChIKey | CAVQBDOACNULDN-NRCOEFLKSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudoephedrine sulfate (CHEBI:756364) is a alkylbenzene (CHEBI:38976) |
| Synonyms | Source |
|---|---|
| D-pseudoephedrine sulfate | ChEMBL |
| Pseudoephedrine sulphate | ChEMBL |
| SCH 4855 | ChEMBL |
| SCH-4855 | ChEMBL |
| Brand Names | Source |
|---|---|
| Afrinol | ChEMBL |
| Pseudoephedrine sulfate component of brompheril | ChEMBL |
| Pseudoephedrine sulfate component of clarinex-d | ChEMBL |
| Pseudoephedrine sulfate component of claritin-d | ChEMBL |
| Pseudoephedrine sulfate component of disobrom | ChEMBL |
| Pseudoephedrine sulfate component of disophrol | ChEMBL |