EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756352 - zylofuramine
| Formula | C14H21NO |
| Net Charge | 0 |
| Average Mass | 219.328 |
| Monoisotopic Mass | 219.16231 |
| SMILES | [H][C@](Cc1ccccc1)(NCC)[C@@]1([H])CCCO1 |
| InChI | InChI=1S/C14H21NO/c1-2-15-13(14-9-6-10-16-14)11-12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3/t13-,14-/m1/s1 |
| InChIKey | DOFCLOLKFGSRTG-ZIAGYGMSSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zylofuramine (CHEBI:756352) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| zilofuramina | WHO MedNet |
| zylofuramine | WHO MedNet |