EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H37N7O20P3S |
| Net Charge | -5 |
| Average Mass | 892.600 |
| Monoisotopic Mass | 892.10544 |
| SMILES | C[C@H](C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)([O-])[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C26H42N7O20P3S/c1-12(16(35)24(39)40)25(41)57-7-6-28-14(34)4-5-29-22(38)19(37)26(2,3)9-50-56(47,48)53-55(45,46)49-8-13-18(52-54(42,43)44)17(36)23(51-13)33-11-32-15-20(27)30-10-31-21(15)33/h10-13,16-19,23,35-37H,4-9H2,1-3H3,(H,28,34)(H,29,38)(H,39,40)(H,45,46)(H,47,48)(H2,27,30,31)(H2,42,43,44)/p-5/t12-,13+,16+,17+,18+,19-,23+/m0/s1 |
| InChIKey | OTENCPQKSBPYCM-IGVLTWCCSA-I |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-erythro-3-methylmalyl-CoA(5−) (CHEBI:75634) is a acyl-CoA oxoanion (CHEBI:58946) |
| L-erythro-3-methylmalyl-CoA(5−) (CHEBI:75634) is conjugate base of L-erythro-3-methylmalyl-CoA (CHEBI:27855) |
| Incoming Relation(s) |
| L-erythro-3-methylmalyl-CoA (CHEBI:27855) is conjugate acid of L-erythro-3-methylmalyl-CoA(5−) (CHEBI:75634) |
| Synonym | Source |
|---|---|
| L-erythro-3-methylmalyl-coenzyme A | ChEBI |
| UniProt Name | Source |
|---|---|
| (2R,3S)-β-methylmalyl-CoA | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9409 | MetaCyc |
| Citations |
|---|