EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756333 - ritrosulfan
| Formula | C10H24N2O8S2 |
| Net Charge | 0 |
| Average Mass | 364.442 |
| Monoisotopic Mass | 364.09741 |
| SMILES | CS(=O)(=O)OCCNC[C@@H](O)[C@@H](O)CNCCOS(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O8S2/c1-21(15,16)19-5-3-11-7-9(13)10(14)8-12-4-6-20-22(2,17)18/h9-14H,3-8H2,1-2H3/t9-,10+ |
| InChIKey | BYZJBHCTZJGJFV-AOOOYVTPSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ritrosulfan (CHEBI:756333) is a sulfonic acid derivative (CHEBI:33552) |
| INNs | Source |
|---|---|
| ritrosulfan | WHO MedNet |
| ritrosulfano | WHO MedNet |
| Synonym | Source |
|---|---|
| NSC-122402 | ChEMBL |
| Citations |
|---|