EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C51H74O19 |
| Net Charge | 0 |
| Average Mass | 991.134 |
| Monoisotopic Mass | 990.48243 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](C5=CC(=O)OC5)[C@@H](OC(C)=O)C[C@]34O)[C@@]1(C)CC[C@H](O[C@H]1C[C@H](OC(C)=O)[C@H](O[C@H]3C[C@H](OC(C)=O)[C@H](O[C@H]4C[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](C)O4)[C@@H](C)O3)[C@@H](C)O1)C2 |
| InChI | InChI=1S/C51H74O19/c1-24-46(67-31(8)56)37(63-27(4)52)20-43(61-24)69-48-26(3)62-44(21-39(48)65-29(6)54)70-47-25(2)60-42(19-38(47)64-28(5)53)68-34-13-15-49(9)33(18-34)11-12-36-35(49)14-16-50(10)45(32-17-41(57)59-23-32)40(66-30(7)55)22-51(36,50)58/h17,24-26,33-40,42-48,58H,11-16,18-23H2,1-10H3/t24-,25-,26-,33-,34+,35+,36-,37+,38+,39+,40+,42+,43+,44+,45+,46-,47-,48-,49+,50-,51+/m1/s1 |
| InChIKey | JDYLJSDIEBHXPO-ALNZGLKXSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pengitoxin (CHEBI:756330) is a cardenolide glycoside (CHEBI:38092) |
| INNs | Source |
|---|---|
| pengitoxin | WHO MedNet |
| pengitoxina | WHO MedNet |
| pengitoxine | WHO MedNet |
| Synonym | Source |
|---|---|
| Gitoxin pentaacetate | ChEMBL |