EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H38N2O6 |
| Net Charge | 0 |
| Average Mass | 534.653 |
| Monoisotopic Mass | 534.27299 |
| SMILES | CCOC(=O)[C@H](CCCc1ccccc1)C1(C(=O)N[C@H]2CCc3ccccc3N(CC(=O)O)C2=O)CCCC1 |
| InChI | InChI=1S/C31H38N2O6/c1-2-39-29(37)24(15-10-13-22-11-4-3-5-12-22)31(19-8-9-20-31)30(38)32-25-18-17-23-14-6-7-16-26(23)33(28(25)36)21-27(34)35/h3-7,11-12,14,16,24-25H,2,8-10,13,15,17-21H2,1H3,(H,32,38)(H,34,35)/t24-,25-/m0/s1 |
| InChIKey | FVWPYVZWVOLAOP-DQEYMECFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daglutril (CHEBI:756319) has role antihypertensive agent (CHEBI:35674) |
| daglutril (CHEBI:756319) is a dipeptide (CHEBI:46761) |
| INNs | Source |
|---|---|
| daglutril | WHO MedNet |
| daglutrilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| SLV-306 | ChEMBL |
| SLV306 | ChEMBL |