EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756303 - amiflamine
| Formula | C12H20N2 |
| Net Charge | 0 |
| Average Mass | 192.306 |
| Monoisotopic Mass | 192.16265 |
| SMILES | Cc1cc(N(C)C)ccc1C[C@H](C)N |
| InChI | InChI=1S/C12H20N2/c1-9-7-12(14(3)4)6-5-11(9)8-10(2)13/h5-7,10H,8,13H2,1-4H3/t10-/m0/s1 |
| InChIKey | HFQMYSHATTXRTC-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amiflamine (CHEBI:756303) is a amphetamines (CHEBI:35338) |
| INNs | Source |
|---|---|
| amiflamina | WHO MedNet |
| amiflamine | WHO MedNet |