EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8N2O3 |
| Net Charge | 0 |
| Average Mass | 180.163 |
| Monoisotopic Mass | 180.05349 |
| SMILES | O=C(O)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C8H8N2O3/c11-7(12)5-10-8(13)6-2-1-3-9-4-6/h1-4H,5H2,(H,10,13)(H,11,12) |
| InChIKey | ZBSGKPYXQINNGF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-nicotinoylglycine (CHEBI:7563) has role human urinary metabolite (CHEBI:84087) |
| N-nicotinoylglycine (CHEBI:7563) is a N-acylglycine (CHEBI:16180) |
| Synonyms | Source |
|---|---|
| Nicotinoylglycine | ChemIDplus |
| Nicotinurate | KEGG COMPOUND |
| Nicotinuric acid | KEGG COMPOUND |
| Nicotinylglycine | KEGG COMPOUND |
| N-Nicotinylglycine | ChemIDplus |
| N-(Pyridin-3-ylcarbonyl)glycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05380 | KEGG COMPOUND |
| HMDB0003269 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8859 | Reaxys |
| CAS:583-08-4 | ChemIDplus |
| CAS:583-08-4 | KEGG COMPOUND |
| Citations |
|---|