EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756283 - piroxantrone hydrochloride
| Formula | HCl.C21H25N5O4.HCl |
| Net Charge | 0 |
| Average Mass | 484.384 |
| Monoisotopic Mass | 483.14401 |
| SMILES | Cl.Cl.NCCCNc1ccc2c3c(nn2CCNCCO)-c2c(O)ccc(O)c2C(=O)c13 |
| InChI | InChI=1S/C21H25N5O4.2ClH/c22-6-1-7-24-12-2-3-13-17-16(12)21(30)19-15(29)5-4-14(28)18(19)20(17)25-26(13)10-8-23-9-11-27;;/h2-5,23-24,27-29H,1,6-11,22H2;2*1H |
| InChIKey | PPASFTRHCXASPY-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroxantrone hydrochloride (CHEBI:756283) is a anthracenes (CHEBI:46955) |
| Synonyms | Source |
|---|---|
| CI-942 | ChEMBL |
| Piroxantrone hcl | ChEMBL |
| Piroxantrone hydrochloride | ChEMBL |