EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C26H34O5S.C2H8N2 |
| Net Charge | 0 |
| Average Mass | 536.735 |
| Monoisotopic Mass | 536.29201 |
| SMILES | NCCN.O.O=C(O)CCS[C@H](c1ccccc1CCCCCCCCc1ccccc1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C26H34O5S.C2H8N2.H2O/c27-23(28)18-19-32-25(24(29)26(30)31)22-17-11-10-16-21(22)15-9-4-2-1-3-6-12-20-13-7-5-8-14-20;3-1-2-4;/h5,7-8,10-11,13-14,16-17,24-25,29H,1-4,6,9,12,15,18-19H2,(H,27,28)(H,30,31);1-4H2;1H2/t24-,25-;;/m1../s1 |
| InChIKey | DIUCVZXIHDZZBV-LBDKHHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pobilukast edamine (CHEBI:756280) is a benzenes (CHEBI:22712) |
| pobilukast edamine (CHEBI:756280) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| Pobilukast edamine | ChEMBL |
| (-)-pobilukast edamine anhydrous | ChEMBL |
| Pobilukast edamine anhydrous | ChEMBL |
| Pobilukast edamine monohydrate | ChEMBL |
| SK&F 104353-Q | ChEMBL |
| SK&F-104353-Q | ChEMBL |