EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756279 - cefivitril
| Formula | C15H15N7O4S3 |
| Net Charge | 0 |
| Average Mass | 453.531 |
| Monoisotopic Mass | 453.03476 |
| SMILES | [H][C@]12SCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)CS/C=C\C#N |
| InChI | InChI=1S/C15H15N7O4S3/c1-21-15(18-19-20-21)29-6-8-5-28-13-10(12(24)22(13)11(8)14(25)26)17-9(23)7-27-4-2-3-16/h2,4,10,13H,5-7H2,1H3,(H,17,23)(H,25,26)/b4-2-/t10-,13-/m1/s1 |
| InChIKey | JXHWKLWIYBATLL-GMIKGCRTSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefivitril (CHEBI:756279) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefivitril | WHO MedNet |
| cefivitrilo | WHO MedNet |