EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756276 - gepefrine
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | C[C@H](N)Cc1cccc(O)c1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)5-8-3-2-4-9(11)6-8/h2-4,6-7,11H,5,10H2,1H3/t7-/m0/s1 |
| InChIKey | WTDGMHYYGNJEKQ-ZETCQYMHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gepefrine (CHEBI:756276) has role cardiovascular drug (CHEBI:35554) |
| gepefrine (CHEBI:756276) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| gepefrina | WHO MedNet |
| Synonym | Source |
|---|---|
| D-.alpha.-methyl-m-tyramine | ChEMBL |