EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H11NO3.C11H6ClN3O6.C4H11NO3 |
| Net Charge | 0 |
| Average Mass | 553.909 |
| Monoisotopic Mass | 553.14230 |
| SMILES | N#Cc1cc(NC(=O)C(=O)O)c(Cl)c(NC(=O)C(=O)O)c1.NC(CO)(CO)CO.NC(CO)(CO)CO |
| InChI | InChI=1S/C11H6ClN3O6.2C4H11NO3/c12-7-5(14-8(16)10(18)19)1-4(3-13)2-6(7)15-9(17)11(20)21;2*5-4(1-6,2-7)3-8/h1-2H,(H,14,16)(H,15,17)(H,18,19)(H,20,21);2*6-8H,1-3,5H2 |
| InChIKey | JJOFNSLZHKIJEV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lodoxamide tromethamine (CHEBI:756272) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Lodoxamide tromethamine salt | ChEMBL |
| U-42585E | ChEMBL |
| Brand Name | Source |
|---|---|
| Alomide allergy | ChEMBL |