EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13Cl2N3O |
| Net Charge | 0 |
| Average Mass | 334.206 |
| Monoisotopic Mass | 333.04357 |
| SMILES | O=C(c1ccccc1)N1CCN/C1=N\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H13Cl2N3O/c17-12-7-4-8-13(18)14(12)20-16-19-9-10-21(16)15(22)11-5-2-1-3-6-11/h1-8H,9-10H2,(H,19,20) |
| InChIKey | YHEMKMZUJKPOCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benclonidine (CHEBI:756271) is a benzoic acids (CHEBI:22723) |
| INNs | Source |
|---|---|
| benclonidina | WHO MedNet |
| benclonidine | WHO MedNet |