EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21ClN4O9 |
| Net Charge | 0 |
| Average Mass | 472.838 |
| Monoisotopic Mass | 472.09971 |
| SMILES | CC1(C)O[C@@H]2[C@@H](COC(=O)c3ccc([N+](=O)[O-])cc3)OC(NC(=O)N(CCCl)N=O)[C@@H]2O1 |
| InChI | InChI=1S/C18H21ClN4O9/c1-18(2)31-13-12(9-29-16(24)10-3-5-11(6-4-10)23(27)28)30-15(14(13)32-18)20-17(25)22(21-26)8-7-19/h3-6,12-15H,7-9H2,1-2H3,(H,20,25)/t12-,13-,14-,15?/m1/s1 |
| InChIKey | YASNUXZKZNVXIS-CBNXCZCTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bofumustine (CHEBI:756257) is a nitrobenzoic acid (CHEBI:25553) |
| INNs | Source |
|---|---|
| bofumustina | WHO MedNet |
| bofumustine | WHO MedNet |
| Synonym | Source |
|---|---|
| NSC-279194 | ChEMBL |