EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C34H65N3O5S.C3H6O3 |
| Net Charge | 0 |
| Average Mass | 736.070 |
| Monoisotopic Mass | 735.50675 |
| SMILES | C[C@H](O)C(=O)O.O.[H][C@]12C[C@@H](NCCCNCCCCN)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@@H](OS(=O)(=O)O)C(C)C)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C34H65N3O5S.C3H6O3.H2O/c1-23(2)31(42-43(39,40)41)12-9-24(3)27-10-11-28-32-29(14-16-34(27,28)5)33(4)15-13-26(21-25(33)22-30(32)38)37-20-8-19-36-18-7-6-17-35;1-2(4)3(5)6;/h23-32,36-38H,6-22,35H2,1-5H3,(H,39,40,41);2,4H,1H3,(H,5,6);1H2/t24-,25-,26+,27-,28+,29+,30-,31-,32+,33+,34-;2-;/m10./s1 |
| InChIKey | ZPYIELFRIYUVQP-BHBJEIPNSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| squalamine lactate (CHEBI:756250) has role antineoplastic agent (CHEBI:35610) |
| squalamine lactate (CHEBI:756250) has role ophthalmology drug (CHEBI:66981) |
| squalamine lactate (CHEBI:756250) is a hydroxy steroid (CHEBI:35350) |
| Synonyms | Source |
|---|---|
| MSI-1256F | ChEMBL |
| Squalamine lactate | ChEMBL |
| Squalamine lactate hydrate | ChEMBL |