EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O3S.C17H19ClN5O4P |
| Net Charge | 0 |
| Average Mass | 519.904 |
| Monoisotopic Mass | 519.07443 |
| SMILES | CS(=O)(=O)O.Nc1ncnc2c1ncn2CCOC[P@@]1(=O)OCC[C@@H](c2cccc(Cl)c2)O1 |
| InChI | InChI=1S/C17H19ClN5O4P.CH4O3S/c18-13-3-1-2-12(8-13)14-4-6-26-28(24,27-14)11-25-7-5-23-10-22-15-16(19)20-9-21-17(15)23;1-5(2,3)4/h1-3,8-10,14H,4-7,11H2,(H2,19,20,21);1H3,(H,2,3,4)/t14-,28+;/m0./s1 |
| InChIKey | JXQUAHHUSMJUFV-HZPZRMRQSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pradefovir mesylate (CHEBI:756229) has role anti-HBV agent (CHEBI:64951) |
| pradefovir mesylate (CHEBI:756229) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| Mb06866 | ChEMBL |
| Pradefovir mesilate | ChEMBL |
| Pradefovir mesylate | ChEMBL |