EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756209 - pentizidone sodium
| Formula | H2O.C8H11N2O3.Na |
| Net Charge | 0 |
| Average Mass | 224.192 |
| Monoisotopic Mass | 224.07730 |
| SMILES | CC(=O)/C=C(/C)N[C@@H]1CON=C1[O-].O.[Na+] |
| InChI | InChI=1S/C8H12N2O3.Na.H2O/c1-5(3-6(2)11)9-7-4-13-10-8(7)12;;/h3,7,9H,4H2,1-2H3,(H,10,12);;1H2/q;+1;/p-1/b5-3-;;/t7-;;/m1../s1 |
| InChIKey | SSRFOWNTANPSFN-IGFAQZEQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentizidone sodium (CHEBI:756209) is a isoxazoles (CHEBI:55373) |
| Synonyms | Source |
|---|---|
| Pentizidone sodium | ChEMBL |
| Pentizidone sodium hemihydrate | ChEMBL |