EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H44N2O.HCl |
| Net Charge | 0 |
| Average Mass | 461.562 |
| Monoisotopic Mass | 460.29872 |
| SMILES | Cl.Cl.[H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](N(C)CCCN(C)C)CC[C@@]21[H] |
| InChI | InChI=1S/C25H44N2O.2ClH/c1-24-13-11-19(28)17-18(24)7-8-20-21-9-10-23(25(21,2)14-12-22(20)24)27(5)16-6-15-26(3)4;;/h7,19-23,28H,6,8-17H2,1-5H3;2*1H/t19-,20-,21-,22-,23-,24-,25-;;/m0../s1 |
| InChIKey | BZFBDUQOBQHBSZ-DLCQERRASA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azacosterol hydrochloride (CHEBI:756198) has role androgen (CHEBI:50113) |
| azacosterol hydrochloride (CHEBI:756198) is a 3-hydroxy steroid (CHEBI:36834) |
| Synonyms | Source |
|---|---|
| Azacosterol dihydrochloride | ChEMBL |
| Azacosterol hcl | ChEMBL |
| Azacosterol hydrochloride | ChEMBL |
| Diazacholesterol dihydrochloride | ChEMBL |
| SC-12937 | ChEMBL |