EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26O12 |
| Net Charge | 0 |
| Average Mass | 578.526 |
| Monoisotopic Mass | 578.14243 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc2c(c1O)C[C@@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C30H26O12/c31-13-7-19(36)24-23(8-13)42-30(12-2-4-16(33)18(35)6-12)28(40)26(24)25-20(37)10-22-14(27(25)39)9-21(38)29(41-22)11-1-3-15(32)17(34)5-11/h1-8,10,21,26,28-40H,9H2/t21-,26+,28+,29-,30-/m1/s1 |
| InChIKey | GMISZFQPFDAPGI-JJYFIROESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| procyanidin B8 (CHEBI:75618) has functional parent (+)-catechin (CHEBI:15600) |
| procyanidin B8 (CHEBI:75618) has functional parent (−)-epicatechin (CHEBI:90) |
| procyanidin B8 (CHEBI:75618) has role metabolite (CHEBI:25212) |
| procyanidin B8 (CHEBI:75618) is a biflavonoid (CHEBI:50128) |
| procyanidin B8 (CHEBI:75618) is a hydroxyflavan (CHEBI:72010) |
| procyanidin B8 (CHEBI:75618) is a polyphenol (CHEBI:26195) |
| procyanidin B8 (CHEBI:75618) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (2R,2'R,3S,3'R,4R)-2,2'-bis(3,4-dihydroxyphenyl)-3,3',4,4'-tetrahydro-2H,2'H-4,6'-bichromene-3,3',5,5',7,7'-hexol |
| Synonym | Source |
|---|---|
| catechin-(4α→6)-epicatechin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038369 | HMDB |
| Procyanidin_B8 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4902614 | Reaxys |
| CAS:12798-60-6 | HMDB |