EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O4S.C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 383.422 |
| Monoisotopic Mass | 383.10387 |
| SMILES | O=S(=O)(O)O.[H][C@@]12CCC(=O)[C@]3([H])Oc4c(O)ccc5c4[C@]13CCN(C)[C@]2([H])C5 |
| InChI | InChI=1S/C17H19NO3.H2O4S/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18;1-5(2,3)4/h2,4,10-11,16,19H,3,5-8H2,1H3;(H2,1,2,3,4)/t10-,11+,16-,17-;/m0./s1 |
| InChIKey | JBBINZRUTLUBFR-NRGUFEMZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydromorphone sulfate (CHEBI:756166) is a morphinane alkaloid (CHEBI:25418) |
| Synonym | Source |
|---|---|
| Hydromorphone sulfate | ChEMBL |