EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H56N4O9.H2O4S |
| Net Charge | 0 |
| Average Mass | 907.052 |
| Monoisotopic Mass | 906.37211 |
| SMILES | O=S(=O)(O)O.[H][C@]12C[C@H](CC)CN(CCc3c(nc4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C=O)[C@]3([H])[C@]45CCN4CC=C[C@@](CC)([C@@H](OC(C)=O)[C@]3(O)C(=O)OC)[C@]45[H])C1)C2 |
| InChI | InChI=1S/C46H56N4O9.H2O4S/c1-7-28-20-29-23-45(41(53)57-5,37-31(14-18-48(24-28)25-29)30-12-9-10-13-34(30)47-37)33-21-32-35(22-36(33)56-4)50(26-51)39-44(32)16-19-49-17-11-15-43(8-2,38(44)49)40(59-27(3)52)46(39,55)42(54)58-6;1-5(2,3)4/h9-13,15,21-22,26,28-29,38-40,47,55H,7-8,14,16-20,23-25H2,1-6H3;(H2,1,2,3,4)/t28-,29-,38-,39+,40+,43+,44+,45-,46-;/m0./s1 |
| InChIKey | BCXOZISMDZTYHW-IFQBWSDRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vinepidine sulfate (CHEBI:756132) is a vinca alkaloid (CHEBI:27288) |
| Synonyms | Source |
|---|---|
| LY 119863 | ChEMBL |
| LY-119863 | ChEMBL |
| Vinepidine sulfate | ChEMBL |
| Vinepidine sulphate | ChEMBL |