EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C10H14N2O8.Na.Na.H2O |
| Net Charge | 0 |
| Average Mass | 372.238 |
| Monoisotopic Mass | 372.07568 |
| SMILES | O.O.O=C([O-])CN(CCN(CC(=O)[O-])CC(=O)O)CC(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C10H16N2O8.2Na.2H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;2*1H2/q;2*+1;;/p-2 |
| InChIKey | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edetate disodium (CHEBI:756112) has functional parent tetracarboxylic acid (CHEBI:35742) |
| edetate disodium (CHEBI:756112) has role cardiovascular drug (CHEBI:35554) |
| edetate disodium (CHEBI:756112) has role hypoglycemic agent (CHEBI:35526) |
| edetate disodium (CHEBI:756112) has role ophthalmology drug (CHEBI:66981) |
| edetate disodium (CHEBI:756112) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| Chelest f-na | ChEMBL |
| Dinatrii edetas | ChEMBL |
| Disodium edetate hydrate | ChEMBL |
| Dissolvine na2-p | ChEMBL |
| E-386 | ChEMBL |
| Edeta bd | ChEMBL |
| Brand Names | Source |
|---|---|
| Sodium versenate | ChEMBL |
| Versene na | ChEMBL |