EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O5S |
| Net Charge | 0 |
| Average Mass | 326.374 |
| Monoisotopic Mass | 326.09364 |
| SMILES | [H][C@]12[C@@H](C)C(S[C@H]3CNC(=O)C3)=C(C(=O)O)N1C(=O)[C@]2([H])[C@@H](C)O |
| InChI | InChI=1S/C14H18N2O5S/c1-5-10-9(6(2)17)13(19)16(10)11(14(20)21)12(5)22-7-3-8(18)15-4-7/h5-7,9-10,17H,3-4H2,1-2H3,(H,15,18)(H,20,21)/t5-,6-,7-,9-,10-/m1/s1 |
| InChIKey | CTEFNVKDRWMZSL-CTNSIQBBSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tacapenem (CHEBI:756106) is a carbapenems (CHEBI:46633) |
| INN | Source |
|---|---|
| tacapenem | WHO MedNet |
| Synonyms | Source |
|---|---|
| R-95867 | ChEMBL |
| R95867 | ChEMBL |