EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756092 - norlevorphanol
| Formula | C16H21NO |
| Net Charge | 0 |
| Average Mass | 243.350 |
| Monoisotopic Mass | 243.16231 |
| SMILES | [H][C@@]12CCCC[C@@]13CCN[C@]2([H])Cc1ccc(O)cc13 |
| InChI | InChI=1S/C16H21NO/c18-12-5-4-11-9-15-13-3-1-2-6-16(13,7-8-17-15)14(11)10-12/h4-5,10,13,15,17-18H,1-3,6-9H2/t13-,15+,16+/m0/s1 |
| InChIKey | IYNWSQDZXMGGGI-NUEKZKHPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norlevorphanol (CHEBI:756092) is a morphinane alkaloid (CHEBI:25418) |
| INNs | Source |
|---|---|
| norlevorfanol | WHO MedNet |
| norlevorphanol | WHO MedNet |
| Synonyms | Source |
|---|---|
| IDS-NN-006 | ChEMBL |
| NIH-7539 | ChEMBL |
| Citations |
|---|